C18H22FN3O5 — CID 7691299
[(2S)-1-(4-fluoroanilino)-1-oxopropan-2-yl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 7691299) has the molecular formula C18H22FN3O5 and a molecular weight of 379.39 g/mol. Its IUPAC name is [(2S)-1-(4-fluoroanilino)-1-oxopropan-2-yl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | [(2S)-1-(4-fluoroanilino)-1-oxopropan-2-yl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 7691299 |
| Molecular Formula | C18H22FN3O5 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | [(2S)-1-(4-fluoroanilino)-1-oxopropan-2-yl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)O[C@@H](C)C(=O)Nc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C18H22FN3O5/c1-4-18(5-2)16(25)22(17(26)21-18)10-14(23)27-11(3)15(24)20-13-8-6-12(19)7-9-13/h6-9,11H,4-5,10H2,1-3H3,(H,20,24)(H,21,26)/t11-/m0/s1 |
| InChIKey | JWQKVLBFXTWEMY-NSHDSACASA-N |
| XLogP | 1.81 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|