C23H31N3O5 — CID 8982293
[(2S)-1-(2,3-dihydro-1H-inden-5-ylamino)-1-oxopropan-2-yl] 2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetate (PubChem CID 8982293) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is [(2S)-1-(2,3-dihydro-1H-inden-5-ylamino)-1-oxopropan-2-yl] 2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetate.
| Compound Name | [(2S)-1-(2,3-dihydro-1H-inden-5-ylamino)-1-oxopropan-2-yl] 2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 8982293 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | [(2S)-1-(2,3-dihydro-1H-inden-5-ylamino)-1-oxopropan-2-yl] 2-(2,5-dioxo-4,4-dipropylimidazolidin-1-yl)acetate |
| SMILES | CCCC1(CCC)NC(=O)N(CC(=O)O[C@@H](C)C(=O)Nc2ccc3c(c2)CCC3)C1=O |
| InChI | InChI=1S/C23H31N3O5/c1-4-11-23(12-5-2)21(29)26(22(30)25-23)14-19(27)31-15(3)20(28)24-18-10-9-16-7-6-8-17(16)13-18/h9-10,13,15H,4-8,11-12,14H2,1-3H3,(H,24,28)(H,25,30)/t15-/m0/s1 |
| InChIKey | FFBNPTNCOFOXKW-HNNXBMFYSA-N |
| XLogP | 2.94 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|