C18H21Cl2N3O5 — CID 51473993
[(2R)-1-(2,3-dichloroanilino)-1-oxopropan-2-yl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 51473993) has the molecular formula C18H21Cl2N3O5 and a molecular weight of 430.29 g/mol. Its IUPAC name is [(2R)-1-(2,3-dichloroanilino)-1-oxopropan-2-yl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | [(2R)-1-(2,3-dichloroanilino)-1-oxopropan-2-yl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 51473993 |
| Molecular Formula | C18H21Cl2N3O5 |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | [(2R)-1-(2,3-dichloroanilino)-1-oxopropan-2-yl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)O[C@H](C)C(=O)Nc2cccc(Cl)c2Cl)C1=O |
| InChI | InChI=1S/C18H21Cl2N3O5/c1-4-18(5-2)16(26)23(17(27)22-18)9-13(24)28-10(3)15(25)21-12-8-6-7-11(19)14(12)20/h6-8,10H,4-5,9H2,1-3H3,(H,21,25)(H,22,27)/t10-/m1/s1 |
| InChIKey | WWDDDFRFVOGNSG-SNVBAGLBSA-N |
| XLogP | 2.97 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|