C22H31N3O5 — CID 7691303
[(2S)-1-(2-methyl-6-propan-2-ylanilino)-1-oxopropan-2-yl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 7691303) has the molecular formula C22H31N3O5 and a molecular weight of 417.51 g/mol. Its IUPAC name is [(2S)-1-(2-methyl-6-propan-2-ylanilino)-1-oxopropan-2-yl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | [(2S)-1-(2-methyl-6-propan-2-ylanilino)-1-oxopropan-2-yl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 7691303 |
| Molecular Formula | C22H31N3O5 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | [(2S)-1-(2-methyl-6-propan-2-ylanilino)-1-oxopropan-2-yl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)O[C@@H](C)C(=O)Nc2c(C)cccc2C(C)C)C1=O |
| InChI | InChI=1S/C22H31N3O5/c1-7-22(8-2)20(28)25(21(29)24-22)12-17(26)30-15(6)19(27)23-18-14(5)10-9-11-16(18)13(3)4/h9-11,13,15H,7-8,12H2,1-6H3,(H,23,27)(H,24,29)/t15-/m0/s1 |
| InChIKey | QUGJRPIVHFZXMZ-HNNXBMFYSA-N |
| XLogP | 3.10 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|