C19H22N2O6 — CID 7821918
[(2R)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate (PubChem CID 7821918) has the molecular formula C19H22N2O6 and a molecular weight of 374.39 g/mol. Its IUPAC name is [(2R)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate.
| Compound Name | [(2R)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
|---|---|
| PubChem CID | 7821918 |
| Molecular Formula | C19H22N2O6 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | [(2R)-1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
| SMILES | COc1ccc(C(=O)[C@@H](C)OC(=O)CN2C(=O)NC3(CCCC3)C2=O)cc1 |
| InChI | InChI=1S/C19H22N2O6/c1-12(16(23)13-5-7-14(26-2)8-6-13)27-15(22)11-21-17(24)19(20-18(21)25)9-3-4-10-19/h5-8,12H,3-4,9-11H2,1-2H3,(H,20,25)/t12-/m1/s1 |
| InChIKey | QXLIWXIVKWBXEM-GFCCVEGCSA-N |
| XLogP | 1.67 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|