C19H22FN3O5 — CID 8565755
[(2S)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate (PubChem CID 8565755) has the molecular formula C19H22FN3O5 and a molecular weight of 391.40 g/mol. Its IUPAC name is [(2S)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate.
| Compound Name | [(2S)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
|---|---|
| PubChem CID | 8565755 |
| Molecular Formula | C19H22FN3O5 |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | [(2S)-1-[(4-fluorophenyl)methylamino]-1-oxopropan-2-yl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
| SMILES | C[C@H](OC(=O)CN1C(=O)NC2(CCCC2)C1=O)C(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H22FN3O5/c1-12(16(25)21-10-13-4-6-14(20)7-5-13)28-15(24)11-23-17(26)19(22-18(23)27)8-2-3-9-19/h4-7,12H,2-3,8-11H2,1H3,(H,21,25)(H,22,27)/t12-/m0/s1 |
| InChIKey | QEKNGIYXEGGDLB-LBPRGKRZSA-N |
| XLogP | 1.24 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|