C17H21NO4 — CID 55311890
(1-oxo-1-phenylpropan-2-yl) 2-(2-oxoazepan-1-yl)acetate (PubChem CID 55311890) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is (1-oxo-1-phenylpropan-2-yl) 2-(2-oxoazepan-1-yl)acetate.
| Compound Name | (1-oxo-1-phenylpropan-2-yl) 2-(2-oxoazepan-1-yl)acetate |
|---|---|
| PubChem CID | 55311890 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | (1-oxo-1-phenylpropan-2-yl) 2-(2-oxoazepan-1-yl)acetate |
| SMILES | CC(OC(=O)CN1CCCCCC1=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H21NO4/c1-13(17(21)14-8-4-2-5-9-14)22-16(20)12-18-11-7-3-6-10-15(18)19/h2,4-5,8-9,13H,3,6-7,10-12H2,1H3 |
| InChIKey | FJUOADFQQXIZRQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |