C24H27NO4 — CID 7727421
[(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate (PubChem CID 7727421) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is [(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate.
| Compound Name | [(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate |
|---|---|
| PubChem CID | 7727421 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | [(1S)-1,2-bis(4-methylphenyl)-2-oxoethyl] 2-(2-oxoazepan-1-yl)acetate |
| SMILES | Cc1ccc(C(=O)[C@@H](OC(=O)CN2CCCCCC2=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H27NO4/c1-17-7-11-19(12-8-17)23(28)24(20-13-9-18(2)10-14-20)29-22(27)16-25-15-5-3-4-6-21(25)26/h7-14,24H,3-6,15-16H2,1-2H3/t24-/m0/s1 |
| InChIKey | RHWQAZCXIJSTBC-DEOSSOPVSA-N |
| XLogP | 4.17 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |