C14H23N3O5 — CID 42900132
[1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(2-oxoazepan-1-yl)acetate (PubChem CID 42900132) has the molecular formula C14H23N3O5 and a molecular weight of 313.35 g/mol. Its IUPAC name is [1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(2-oxoazepan-1-yl)acetate.
| Compound Name | [1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(2-oxoazepan-1-yl)acetate |
|---|---|
| PubChem CID | 42900132 |
| Molecular Formula | C14H23N3O5 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | [1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-(2-oxoazepan-1-yl)acetate |
| SMILES | CC(C)C(OC(=O)CN1CCCCCC1=O)C(=O)NC(N)=O |
| InChI | InChI=1S/C14H23N3O5/c1-9(2)12(13(20)16-14(15)21)22-11(19)8-17-7-5-3-4-6-10(17)18/h9,12H,3-8H2,1-2H3,(H3,15,16,20,21) |
| InChIKey | OJQVXGKIWIMQDG-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |