C16H23N3O6 — CID 11923718
[(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate (PubChem CID 11923718) has the molecular formula C16H23N3O6 and a molecular weight of 353.38 g/mol. Its IUPAC name is [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate.
| Compound Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate |
|---|---|
| PubChem CID | 11923718 |
| Molecular Formula | C16H23N3O6 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | [(2S)-1-(carbamoylamino)-3-methyl-1-oxobutan-2-yl] 2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate |
| SMILES | CC(C)[C@H](OC(=O)CN1C(=O)[C@H]2CCCC[C@@H]2C1=O)C(=O)NC(N)=O |
| InChI | InChI=1S/C16H23N3O6/c1-8(2)12(13(21)18-16(17)24)25-11(20)7-19-14(22)9-5-3-4-6-10(9)15(19)23/h8-10,12H,3-7H2,1-2H3,(H3,17,18,21,24)/t9-,10-,12-/m0/s1 |
| InChIKey | ZVEFAXDFZYEVBF-NHCYSSNCSA-N |
| XLogP | -0.08 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|