C25H27N3O4 — CID 42945150
[1,2-bis(4-methylphenyl)-2-oxoethyl] 2-(3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-2-yl)acetate (PubChem CID 42945150) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is [1,2-bis(4-methylphenyl)-2-oxoethyl] 2-(3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-2-yl)acetate.
| Compound Name | [1,2-bis(4-methylphenyl)-2-oxoethyl] 2-(3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-2-yl)acetate |
|---|---|
| PubChem CID | 42945150 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | [1,2-bis(4-methylphenyl)-2-oxoethyl] 2-(3-oxo-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-2-yl)acetate |
| SMILES | Cc1ccc(C(=O)C(OC(=O)Cn2nc3n(c2=O)CCCCC3)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H27N3O4/c1-17-7-11-19(12-8-17)23(30)24(20-13-9-18(2)10-14-20)32-22(29)16-28-25(31)27-15-5-3-4-6-21(27)26-28/h7-14,24H,3-6,15-16H2,1-2H3 |
| InChIKey | GLFKUYANOZCWQC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 83.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |