C16H17N3O5 — CID 24514614
propyl 4-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]benzoate (PubChem CID 24514614) has the molecular formula C16H17N3O5 and a molecular weight of 331.33 g/mol. Its IUPAC name is propyl 4-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]benzoate.
| Compound Name | propyl 4-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 24514614 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | propyl 4-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)Cn2ccc(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C16H17N3O5/c1-2-9-24-15(22)11-3-5-12(6-4-11)17-14(21)10-19-8-7-13(20)18-16(19)23/h3-8H,2,9-10H2,1H3,(H,17,21)(H,18,20,23) |
| InChIKey | MDWPRDYGYIFCHV-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |