C6H8N4O3 — CID 43236986
2-(2,4-dioxopyrimidin-1-yl)acetohydrazide (PubChem CID 43236986) has the molecular formula C6H8N4O3 and a molecular weight of 184.16 g/mol. Its IUPAC name is 2-(2,4-dioxopyrimidin-1-yl)acetohydrazide.
| Compound Name | 2-(2,4-dioxopyrimidin-1-yl)acetohydrazide |
|---|---|
| PubChem CID | 43236986 |
| Molecular Formula | C6H8N4O3 |
| Molecular Weight | 184.16 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 2-(2,4-dioxopyrimidin-1-yl)acetohydrazide |
| SMILES | NNC(=O)Cn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C6H8N4O3/c7-9-5(12)3-10-2-1-4(11)8-6(10)13/h1-2H,3,7H2,(H,9,12)(H,8,11,13) |
| InChIKey | JNLBXORJKSELDK-UHFFFAOYSA-N |
| XLogP | -2.47 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.16 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|