C9H10ClN3O3 — CID 115636712
N-(2-chloroprop-2-enyl)-2-(2,4-dioxopyrimidin-1-yl)acetamide (PubChem CID 115636712) has the molecular formula C9H10ClN3O3 and a molecular weight of 243.65 g/mol. Its IUPAC name is N-(2-chloroprop-2-enyl)-2-(2,4-dioxopyrimidin-1-yl)acetamide.
| Compound Name | N-(2-chloroprop-2-enyl)-2-(2,4-dioxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 115636712 |
| Molecular Formula | C9H10ClN3O3 |
| Molecular Weight | 243.65 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | N-(2-chloroprop-2-enyl)-2-(2,4-dioxopyrimidin-1-yl)acetamide |
| SMILES | C=C(Cl)CNC(=O)Cn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C9H10ClN3O3/c1-6(10)4-11-8(15)5-13-3-2-7(14)12-9(13)16/h2-3H,1,4-5H2,(H,11,15)(H,12,14,16) |
| InChIKey | KABMGBGBAUAIBM-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.65 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |