C10H12N2O5 — CID 63898906
ethyl 4-(2,4-dioxopyrimidin-1-yl)-3-oxobutanoate (PubChem CID 63898906) has the molecular formula C10H12N2O5 and a molecular weight of 240.21 g/mol. Its IUPAC name is ethyl 4-(2,4-dioxopyrimidin-1-yl)-3-oxobutanoate.
| Compound Name | ethyl 4-(2,4-dioxopyrimidin-1-yl)-3-oxobutanoate |
|---|---|
| PubChem CID | 63898906 |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | ethyl 4-(2,4-dioxopyrimidin-1-yl)-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)Cn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C10H12N2O5/c1-2-17-9(15)5-7(13)6-12-4-3-8(14)11-10(12)16/h3-4H,2,5-6H2,1H3,(H,11,14,16) |
| InChIKey | HHNZPKAFBOJYNE-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|