C13H12N4O3S — CID 28945240
N-(3-carbamothioylphenyl)-2-(2,4-dioxopyrimidin-1-yl)acetamide (PubChem CID 28945240) has the molecular formula C13H12N4O3S and a molecular weight of 304.33 g/mol. Its IUPAC name is N-(3-carbamothioylphenyl)-2-(2,4-dioxopyrimidin-1-yl)acetamide.
| Compound Name | N-(3-carbamothioylphenyl)-2-(2,4-dioxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 28945240 |
| Molecular Formula | C13H12N4O3S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | N-(3-carbamothioylphenyl)-2-(2,4-dioxopyrimidin-1-yl)acetamide |
| SMILES | NC(=S)c1cccc(NC(=O)Cn2ccc(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C13H12N4O3S/c14-12(21)8-2-1-3-9(6-8)15-11(19)7-17-5-4-10(18)16-13(17)20/h1-6H,7H2,(H2,14,21)(H,15,19)(H,16,18,20) |
| InChIKey | OBMKSKZLUOOSNB-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|