C14H18N4O2S — CID 63002679
N-(3-carbamothioylphenyl)-2-(5-oxo-1,4-diazepan-1-yl)acetamide (PubChem CID 63002679) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is N-(3-carbamothioylphenyl)-2-(5-oxo-1,4-diazepan-1-yl)acetamide.
| Compound Name | N-(3-carbamothioylphenyl)-2-(5-oxo-1,4-diazepan-1-yl)acetamide |
|---|---|
| PubChem CID | 63002679 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-(3-carbamothioylphenyl)-2-(5-oxo-1,4-diazepan-1-yl)acetamide |
| SMILES | NC(=S)c1cccc(NC(=O)CN2CCNC(=O)CC2)c1 |
| InChI | InChI=1S/C14H18N4O2S/c15-14(21)10-2-1-3-11(8-10)17-13(20)9-18-6-4-12(19)16-5-7-18/h1-3,8H,4-7,9H2,(H2,15,21)(H,16,19)(H,17,20) |
| InChIKey | NIHLYBNFHOMIIG-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|