C13H16FN3OS — CID 55135273
3-fluoro-4-[(5-oxo-1,4-diazepan-1-yl)methyl]benzenecarbothioamide (PubChem CID 55135273) has the molecular formula C13H16FN3OS and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-fluoro-4-[(5-oxo-1,4-diazepan-1-yl)methyl]benzenecarbothioamide.
| Compound Name | 3-fluoro-4-[(5-oxo-1,4-diazepan-1-yl)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 55135273 |
| Molecular Formula | C13H16FN3OS |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 3-fluoro-4-[(5-oxo-1,4-diazepan-1-yl)methyl]benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(CN2CCNC(=O)CC2)c(F)c1 |
| InChI | InChI=1S/C13H16FN3OS/c14-11-7-9(13(15)19)1-2-10(11)8-17-5-3-12(18)16-4-6-17/h1-2,7H,3-6,8H2,(H2,15,19)(H,16,18) |
| InChIKey | LMXXVELVVIZFAP-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|