C13H18FN3O — CID 63002654
1-[[5-(aminomethyl)-2-fluorophenyl]methyl]-1,4-diazepan-5-one (PubChem CID 63002654) has the molecular formula C13H18FN3O and a molecular weight of 251.30 g/mol. Its IUPAC name is 1-[[5-(aminomethyl)-2-fluorophenyl]methyl]-1,4-diazepan-5-one.
| Compound Name | 1-[[5-(aminomethyl)-2-fluorophenyl]methyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 63002654 |
| Molecular Formula | C13H18FN3O |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 1-[[5-(aminomethyl)-2-fluorophenyl]methyl]-1,4-diazepan-5-one |
| SMILES | NCc1ccc(F)c(CN2CCNC(=O)CC2)c1 |
| InChI | InChI=1S/C13H18FN3O/c14-12-2-1-10(8-15)7-11(12)9-17-5-3-13(18)16-4-6-17/h1-2,7H,3-6,8-9,15H2,(H,16,18) |
| InChIKey | RAENIZSLCGWEEH-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |