C15H15FN2S2 — CID 29273112
4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)-3-fluorobenzenecarbothioamide (PubChem CID 29273112) has the molecular formula C15H15FN2S2 and a molecular weight of 306.43 g/mol. Its IUPAC name is 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)-3-fluorobenzenecarbothioamide.
| Compound Name | 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)-3-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 29273112 |
| Molecular Formula | C15H15FN2S2 |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)-3-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1ccc(CN2CCc3sccc3C2)c(F)c1 |
| InChI | InChI=1S/C15H15FN2S2/c16-13-7-10(15(17)19)1-2-11(13)8-18-5-3-14-12(9-18)4-6-20-14/h1-2,4,6-7H,3,5,8-9H2,(H2,17,19) |
| InChIKey | KOAGYDXPSYXVOI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|