C15H17N3OS — CID 43375509
3-amino-4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)benzamide (PubChem CID 43375509) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is 3-amino-4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)benzamide.
| Compound Name | 3-amino-4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)benzamide |
|---|---|
| PubChem CID | 43375509 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 3-amino-4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)benzamide |
| SMILES | NC(=O)c1ccc(CN2CCc3sccc3C2)c(N)c1 |
| InChI | InChI=1S/C15H17N3OS/c16-13-7-10(15(17)19)1-2-11(13)8-18-5-3-14-12(9-18)4-6-20-14/h1-2,4,6-7H,3,5,8-9,16H2,(H2,17,19) |
| InChIKey | UBBNBOOGVGEMPU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|