C13H17ClN4O2 — CID 63004252
N-(4-amino-2-chlorophenyl)-2-(5-oxo-1,4-diazepan-1-yl)acetamide (PubChem CID 63004252) has the molecular formula C13H17ClN4O2 and a molecular weight of 296.76 g/mol. Its IUPAC name is N-(4-amino-2-chlorophenyl)-2-(5-oxo-1,4-diazepan-1-yl)acetamide.
| Compound Name | N-(4-amino-2-chlorophenyl)-2-(5-oxo-1,4-diazepan-1-yl)acetamide |
|---|---|
| PubChem CID | 63004252 |
| Molecular Formula | C13H17ClN4O2 |
| Molecular Weight | 296.76 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | N-(4-amino-2-chlorophenyl)-2-(5-oxo-1,4-diazepan-1-yl)acetamide |
| SMILES | Nc1ccc(NC(=O)CN2CCNC(=O)CC2)c(Cl)c1 |
| InChI | InChI=1S/C13H17ClN4O2/c14-10-7-9(15)1-2-11(10)17-13(20)8-18-5-3-12(19)16-4-6-18/h1-2,7H,3-6,8,15H2,(H,16,19)(H,17,20) |
| InChIKey | RPNUMTACWDVPEF-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.76 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|