C14H19ClN4O2 — CID 65361182
N-(4-amino-2-chlorophenyl)-3-(3-oxo-1,4-diazepan-1-yl)propanamide (PubChem CID 65361182) has the molecular formula C14H19ClN4O2 and a molecular weight of 310.78 g/mol. Its IUPAC name is N-(4-amino-2-chlorophenyl)-3-(3-oxo-1,4-diazepan-1-yl)propanamide.
| Compound Name | N-(4-amino-2-chlorophenyl)-3-(3-oxo-1,4-diazepan-1-yl)propanamide |
|---|---|
| PubChem CID | 65361182 |
| Molecular Formula | C14H19ClN4O2 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | N-(4-amino-2-chlorophenyl)-3-(3-oxo-1,4-diazepan-1-yl)propanamide |
| SMILES | Nc1ccc(NC(=O)CCN2CCCNC(=O)C2)c(Cl)c1 |
| InChI | InChI=1S/C14H19ClN4O2/c15-11-8-10(16)2-3-12(11)18-13(20)4-7-19-6-1-5-17-14(21)9-19/h2-3,8H,1,4-7,9,16H2,(H,17,21)(H,18,20) |
| InChIKey | YVCADJYKSRLSPV-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|