C14H13BrClN3O2 — CID 114760129
N-(4-amino-2-chlorophenyl)-3-(3-bromo-2-oxo-1-pyridinyl)propanamide (PubChem CID 114760129) has the molecular formula C14H13BrClN3O2 and a molecular weight of 370.63 g/mol. Its IUPAC name is N-(4-amino-2-chlorophenyl)-3-(3-bromo-2-oxo-1-pyridinyl)propanamide.
| Compound Name | N-(4-amino-2-chlorophenyl)-3-(3-bromo-2-oxo-1-pyridinyl)propanamide |
|---|---|
| PubChem CID | 114760129 |
| Molecular Formula | C14H13BrClN3O2 |
| Molecular Weight | 370.63 g/mol |
| Exact Mass | 368.99 |
| IUPAC Name | N-(4-amino-2-chlorophenyl)-3-(3-bromo-2-oxo-1-pyridinyl)propanamide |
| SMILES | Nc1ccc(NC(=O)CCn2cccc(Br)c2=O)c(Cl)c1 |
| InChI | InChI=1S/C14H13BrClN3O2/c15-10-2-1-6-19(14(10)21)7-5-13(20)18-12-4-3-9(17)8-11(12)16/h1-4,6,8H,5,7,17H2,(H,18,20) |
| InChIKey | DMQIHDAJJPIIRY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.63 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|