C13H17FN4O2 — CID 16779095
N-(5-amino-2-fluorophenyl)-3-(3-oxopiperazin-1-yl)propanamide (PubChem CID 16779095) has the molecular formula C13H17FN4O2 and a molecular weight of 280.30 g/mol. Its IUPAC name is N-(5-amino-2-fluorophenyl)-3-(3-oxopiperazin-1-yl)propanamide.
| Compound Name | N-(5-amino-2-fluorophenyl)-3-(3-oxopiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 16779095 |
| Molecular Formula | C13H17FN4O2 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | N-(5-amino-2-fluorophenyl)-3-(3-oxopiperazin-1-yl)propanamide |
| SMILES | Nc1ccc(F)c(NC(=O)CCN2CCNC(=O)C2)c1 |
| InChI | InChI=1S/C13H17FN4O2/c14-10-2-1-9(15)7-11(10)17-12(19)3-5-18-6-4-16-13(20)8-18/h1-2,7H,3-6,8,15H2,(H,16,20)(H,17,19) |
| InChIKey | YNZXSBKYWMFIKM-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|