C12H12F3N3O2 — CID 2656976
2-(3-oxopiperazin-1-yl)-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 2656976) has the molecular formula C12H12F3N3O2 and a molecular weight of 287.24 g/mol. Its IUPAC name is 2-(3-oxopiperazin-1-yl)-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(3-oxopiperazin-1-yl)-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 2656976 |
| Molecular Formula | C12H12F3N3O2 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-(3-oxopiperazin-1-yl)-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C1CN(CC(=O)Nc2ccc(F)c(F)c2F)CCN1 |
| InChI | InChI=1S/C12H12F3N3O2/c13-7-1-2-8(12(15)11(7)14)17-10(20)6-18-4-3-16-9(19)5-18/h1-2H,3-6H2,(H,16,19)(H,17,20) |
| InChIKey | RIPKLVULGRYUOO-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|