C23H32Cl2N6O2 — CID 162243839
N-(4-amino-2-chlorophenyl)-2-(dimethylamino)acetamide;N-(4-amino-2-chlorophenyl)-2-piperidin-1-ylacetamide (PubChem CID 162243839) has the molecular formula C23H32Cl2N6O2 and a molecular weight of 495.46 g/mol. Its IUPAC name is N-(4-amino-2-chlorophenyl)-2-(dimethylamino)acetamide;N-(4-amino-2-chlorophenyl)-2-piperidin-1-ylacetamide.
| Compound Name | N-(4-amino-2-chlorophenyl)-2-(dimethylamino)acetamide;N-(4-amino-2-chlorophenyl)-2-piperidin-1-ylacetamide |
|---|---|
| PubChem CID | 162243839 |
| Molecular Formula | C23H32Cl2N6O2 |
| Molecular Weight | 495.46 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | N-(4-amino-2-chlorophenyl)-2-(dimethylamino)acetamide;N-(4-amino-2-chlorophenyl)-2-piperidin-1-ylacetamide |
| SMILES | CN(C)CC(=O)Nc1ccc(N)cc1Cl.Nc1ccc(NC(=O)CN2CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C13H18ClN3O.C10H14ClN3O/c14-11-8-10(15)4-5-12(11)16-13(18)9-17-6-2-1-3-7-17;1-14(2)6-10(15)13-9-4-3-7(12)5-8(9)11/h4-5,8H,1-3,6-7,9,15H2,(H,16,18);3-5H,6,12H2,1-2H3,(H,13,15) |
| InChIKey | ZXBGOTALMWWJQT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|