C13H16N2O2 — CID 63004139
1-phenacyl-1,4-diazepan-5-one (PubChem CID 63004139) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 1-phenacyl-1,4-diazepan-5-one.
| Compound Name | 1-phenacyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 63004139 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 1-phenacyl-1,4-diazepan-5-one |
| SMILES | O=C1CCN(CC(=O)c2ccccc2)CCN1 |
| InChI | InChI=1S/C13H16N2O2/c16-12(11-4-2-1-3-5-11)10-15-8-6-13(17)14-7-9-15/h1-5H,6-10H2,(H,14,17) |
| InChIKey | RXWWDENYEPMCJX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |