3-methyl-4-(5-oxo-1,4-diazepan-1-yl)but-2-enoic acid

C10H16N2O3 — CID 77006071

IUPAC3-methyl-4-(5-oxo-1,4-diazepan-1-yl)but-2-enoic acid
SMILESCC(=CC(=O)O)CN1CCNC(=O)CC1
InChIInChI=1S/C10H16N2O3/c1-8(6-10(14)15)7-12-4-2-9(13)11-3-5-12/h6H,2-5,7H2,1H3,(H,11,13)(H,14,15)
InChIKeyKDHWETCFNKCXCA-UHFFFAOYSA-N
MW212.25 g/mol
LogP-0.16
Rot. Bonds3

About 3-methyl-4-(5-oxo-1,4-diazepan-1-yl)but-2-enoic acid

3-methyl-4-(5-oxo-1,4-diazepan-1-yl)but-2-enoic acid (PubChem CID 77006071) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 3-methyl-4-(5-oxo-1,4-diazepan-1-yl)but-2-enoic acid.

Molecular Properties

Compound Name3-methyl-4-(5-oxo-1,4-diazepan-1-yl)but-2-enoic acid
PubChem CID77006071
Molecular FormulaC10H16N2O3
Molecular Weight212.25 g/mol
Exact Mass212.12
IUPAC Name3-methyl-4-(5-oxo-1,4-diazepan-1-yl)but-2-enoic acid
SMILESCC(=CC(=O)O)CN1CCNC(=O)CC1
InChIInChI=1S/C10H16N2O3/c1-8(6-10(14)15)7-12-4-2-9(13)11-3-5-12/h6H,2-5,7H2,1H3,(H,11,13)(H,14,15)
InChIKeyKDHWETCFNKCXCA-UHFFFAOYSA-N
XLogP-0.16
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.25
LogP ≤ 5-0.16
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-methyl-4-(5-oxo-1,4-diazepan-1-yl)but-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methyl-4-(5-oxo-1,4-diazepan-1-yl)but-2-enoic acid?
The IUPAC name of 3-methyl-4-(5-oxo-1,4-diazepan-1-yl)but-2-enoic acid (CID 77006071) is 3-methyl-4-(5-oxo-1,4-diazepan-1-yl)but-2-enoic acid.
What is the SMILES notation for 3-methyl-4-(5-oxo-1,4-diazepan-1-yl)but-2-enoic acid?
The canonical SMILES for 3-methyl-4-(5-oxo-1,4-diazepan-1-yl)but-2-enoic acid is CC(=CC(=O)O)CN1CCNC(=O)CC1.
What is the InChIKey of 3-methyl-4-(5-oxo-1,4-diazepan-1-yl)but-2-enoic acid?
The InChIKey is KDHWETCFNKCXCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O3/c1-8(6-10(14)15)7-12-4-2-9(13)11-3-5-12/h6H,2-5,7H2,1H3,(H,11,13)(H,14,15).
What are the key properties of 3-methyl-4-(5-oxo-1,4-diazepan-1-yl)but-2-enoic acid?
3-methyl-4-(5-oxo-1,4-diazepan-1-yl)but-2-enoic acid has a molecular weight of 212.25 g/mol, XLogP of -0.16, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-(5-oxo-1,4-diazepan-1-yl)but-2-enoic acid is sourced from PubChem (CID 77006071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).