C10H16N2O3 — CID 77006071
3-methyl-4-(5-oxo-1,4-diazepan-1-yl)but-2-enoic acid (PubChem CID 77006071) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 3-methyl-4-(5-oxo-1,4-diazepan-1-yl)but-2-enoic acid.
| Compound Name | 3-methyl-4-(5-oxo-1,4-diazepan-1-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 77006071 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 3-methyl-4-(5-oxo-1,4-diazepan-1-yl)but-2-enoic acid |
| SMILES | CC(=CC(=O)O)CN1CCNC(=O)CC1 |
| InChI | InChI=1S/C10H16N2O3/c1-8(6-10(14)15)7-12-4-2-9(13)11-3-5-12/h6H,2-5,7H2,1H3,(H,11,13)(H,14,15) |
| InChIKey | KDHWETCFNKCXCA-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|