C14H19N3OS2 — CID 61419450
N-(3-carbamothioylphenyl)-2-(1,4-thiazepan-4-yl)acetamide (PubChem CID 61419450) has the molecular formula C14H19N3OS2 and a molecular weight of 309.46 g/mol. Its IUPAC name is N-(3-carbamothioylphenyl)-2-(1,4-thiazepan-4-yl)acetamide.
| Compound Name | N-(3-carbamothioylphenyl)-2-(1,4-thiazepan-4-yl)acetamide |
|---|---|
| PubChem CID | 61419450 |
| Molecular Formula | C14H19N3OS2 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | N-(3-carbamothioylphenyl)-2-(1,4-thiazepan-4-yl)acetamide |
| SMILES | NC(=S)c1cccc(NC(=O)CN2CCCSCC2)c1 |
| InChI | InChI=1S/C14H19N3OS2/c15-14(19)11-3-1-4-12(9-11)16-13(18)10-17-5-2-7-20-8-6-17/h1,3-4,9H,2,5-8,10H2,(H2,15,19)(H,16,18) |
| InChIKey | GEQSZTGZAXIDHM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|