C13H18FN3OS — CID 61418614
N-(3-amino-4-fluorophenyl)-2-(1,4-thiazepan-4-yl)acetamide (PubChem CID 61418614) has the molecular formula C13H18FN3OS and a molecular weight of 283.37 g/mol. Its IUPAC name is N-(3-amino-4-fluorophenyl)-2-(1,4-thiazepan-4-yl)acetamide.
| Compound Name | N-(3-amino-4-fluorophenyl)-2-(1,4-thiazepan-4-yl)acetamide |
|---|---|
| PubChem CID | 61418614 |
| Molecular Formula | C13H18FN3OS |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | N-(3-amino-4-fluorophenyl)-2-(1,4-thiazepan-4-yl)acetamide |
| SMILES | Nc1cc(NC(=O)CN2CCCSCC2)ccc1F |
| InChI | InChI=1S/C13H18FN3OS/c14-11-3-2-10(8-12(11)15)16-13(18)9-17-4-1-6-19-7-5-17/h2-3,8H,1,4-7,9,15H2,(H,16,18) |
| InChIKey | UAAPFNFEPVPBTA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|