C15H17N3O5 — CID 33103569
N-[(2,5-dimethoxyphenyl)methyl]-2-(2,4-dioxopyrimidin-1-yl)acetamide (PubChem CID 33103569) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is N-[(2,5-dimethoxyphenyl)methyl]-2-(2,4-dioxopyrimidin-1-yl)acetamide.
| Compound Name | N-[(2,5-dimethoxyphenyl)methyl]-2-(2,4-dioxopyrimidin-1-yl)acetamide |
|---|---|
| PubChem CID | 33103569 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-[(2,5-dimethoxyphenyl)methyl]-2-(2,4-dioxopyrimidin-1-yl)acetamide |
| SMILES | COc1ccc(OC)c(CNC(=O)Cn2ccc(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C15H17N3O5/c1-22-11-3-4-12(23-2)10(7-11)8-16-14(20)9-18-6-5-13(19)17-15(18)21/h3-7H,8-9H2,1-2H3,(H,16,20)(H,17,19,21) |
| InChIKey | HPJWTXWELVCVNV-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |