C15H17N3O4 — CID 9456600
2-(2,4-dioxopyrimidin-1-yl)-N-[2-(4-methylphenoxy)ethyl]acetamide (PubChem CID 9456600) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 2-(2,4-dioxopyrimidin-1-yl)-N-[2-(4-methylphenoxy)ethyl]acetamide.
| Compound Name | 2-(2,4-dioxopyrimidin-1-yl)-N-[2-(4-methylphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 9456600 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 2-(2,4-dioxopyrimidin-1-yl)-N-[2-(4-methylphenoxy)ethyl]acetamide |
| SMILES | Cc1ccc(OCCNC(=O)Cn2ccc(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C15H17N3O4/c1-11-2-4-12(5-3-11)22-9-7-16-14(20)10-18-8-6-13(19)17-15(18)21/h2-6,8H,7,9-10H2,1H3,(H,16,20)(H,17,19,21) |
| InChIKey | KQSUSDDYCGWICQ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|