About butyl 4-[5-(diethylamino)pentanoylamino]benzoate;hydrochloride
butyl 4-[5-(diethylamino)pentanoylamino]benzoate;hydrochloride (PubChem CID 54599614) has the molecular formula C20H33ClN2O3
and a molecular weight of 384.95 g/mol. Its IUPAC name is butyl 4-[5-(diethylamino)pentanoylamino]benzoate;hydrochloride.
Molecular Properties
| Compound Name | butyl 4-[5-(diethylamino)pentanoylamino]benzoate;hydrochloride |
| PubChem CID | 54599614 |
| Molecular Formula | C20H33ClN2O3 |
| Molecular Weight | 384.95 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | butyl 4-[5-(diethylamino)pentanoylamino]benzoate;hydrochloride |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CCCCN(CC)CC)cc1.Cl |
| InChI | InChI=1S/C20H32N2O3.ClH/c1-4-7-16-25-20(24)17-11-13-18(14-12-17)21-19(23)10-8-9-15-22(5-2)6-3;/h11-14H,4-10,15-16H2,1-3H3,(H,21,23);1H |
| InChIKey | SXCQOOMDBRXYCE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.95 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 4-[5-(diethylamino)pentanoylamino]benzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 4-[5-(diethylamino)pentanoylamino]benzoate;hydrochloride?
The IUPAC name of butyl 4-[5-(diethylamino)pentanoylamino]benzoate;hydrochloride (CID 54599614) is butyl 4-[5-(diethylamino)pentanoylamino]benzoate;hydrochloride.
What is the SMILES notation for butyl 4-[5-(diethylamino)pentanoylamino]benzoate;hydrochloride?
The canonical SMILES for butyl 4-[5-(diethylamino)pentanoylamino]benzoate;hydrochloride is CCCCOC(=O)c1ccc(NC(=O)CCCCN(CC)CC)cc1.Cl.
What is the InChIKey of butyl 4-[5-(diethylamino)pentanoylamino]benzoate;hydrochloride?
The InChIKey is SXCQOOMDBRXYCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32N2O3.ClH/c1-4-7-16-25-20(24)17-11-13-18(14-12-17)21-19(23)10-8-9-15-22(5-2)6-3;/h11-14H,4-10,15-16H2,1-3H3,(H,21,23);1H.
What are the key properties of butyl 4-[5-(diethylamino)pentanoylamino]benzoate;hydrochloride?
butyl 4-[5-(diethylamino)pentanoylamino]benzoate;hydrochloride has a molecular weight of 384.95 g/mol, XLogP of 4.52, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 4-[5-(diethylamino)pentanoylamino]benzoate;hydrochloride is sourced from PubChem (CID 54599614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).