About (2-fluorophenyl) 4-(carbamoylamino)benzoate
(2-fluorophenyl) 4-(carbamoylamino)benzoate (PubChem CID 47098082) has the molecular formula C14H11FN2O3
and a molecular weight of 274.25 g/mol. Its IUPAC name is (2-fluorophenyl) 4-(carbamoylamino)benzoate.
Molecular Properties
| Compound Name | (2-fluorophenyl) 4-(carbamoylamino)benzoate |
| PubChem CID | 47098082 |
| Molecular Formula | C14H11FN2O3 |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (2-fluorophenyl) 4-(carbamoylamino)benzoate |
| SMILES | NC(=O)Nc1ccc(C(=O)Oc2ccccc2F)cc1 |
| InChI | InChI=1S/C14H11FN2O3/c15-11-3-1-2-4-12(11)20-13(18)9-5-7-10(8-6-9)17-14(16)19/h1-8H,(H3,16,17,19) |
| InChIKey | QOYYRJKWYOAEIQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-fluorophenyl) 4-(carbamoylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluorophenyl) 4-(carbamoylamino)benzoate?
The IUPAC name of (2-fluorophenyl) 4-(carbamoylamino)benzoate (CID 47098082) is (2-fluorophenyl) 4-(carbamoylamino)benzoate.
What is the SMILES notation for (2-fluorophenyl) 4-(carbamoylamino)benzoate?
The canonical SMILES for (2-fluorophenyl) 4-(carbamoylamino)benzoate is NC(=O)Nc1ccc(C(=O)Oc2ccccc2F)cc1.
What is the InChIKey of (2-fluorophenyl) 4-(carbamoylamino)benzoate?
The InChIKey is QOYYRJKWYOAEIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11FN2O3/c15-11-3-1-2-4-12(11)20-13(18)9-5-7-10(8-6-9)17-14(16)19/h1-8H,(H3,16,17,19).
What are the key properties of (2-fluorophenyl) 4-(carbamoylamino)benzoate?
(2-fluorophenyl) 4-(carbamoylamino)benzoate has a molecular weight of 274.25 g/mol, XLogP of 2.54, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluorophenyl) 4-(carbamoylamino)benzoate is sourced from PubChem (CID 47098082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).