About benzamide;phenylurea
benzamide;phenylurea (PubChem CID 143432016) has the molecular formula C14H15N3O2
and a molecular weight of 257.29 g/mol. Its IUPAC name is benzamide;phenylurea.
Molecular Properties
| Compound Name | benzamide;phenylurea |
| PubChem CID | 143432016 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | benzamide;phenylurea |
| SMILES | NC(=O)Nc1ccccc1.NC(=O)c1ccccc1 |
| InChI | InChI=1S/C7H8N2O.C7H7NO/c8-7(10)9-6-4-2-1-3-5-6;8-7(9)6-4-2-1-3-5-6/h1-5H,(H3,8,9,10);1-5H,(H2,8,9) |
| InChIKey | YMIXPLNDIAULMY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzamide;phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzamide;phenylurea?
The IUPAC name of benzamide;phenylurea (CID 143432016) is benzamide;phenylurea.
What is the SMILES notation for benzamide;phenylurea?
The canonical SMILES for benzamide;phenylurea is NC(=O)Nc1ccccc1.NC(=O)c1ccccc1.
What is the InChIKey of benzamide;phenylurea?
The InChIKey is YMIXPLNDIAULMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O.C7H7NO/c8-7(10)9-6-4-2-1-3-5-6;8-7(9)6-4-2-1-3-5-6/h1-5H,(H3,8,9,10);1-5H,(H2,8,9).
What are the key properties of benzamide;phenylurea?
benzamide;phenylurea has a molecular weight of 257.29 g/mol, XLogP of 1.96, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzamide;phenylurea is sourced from PubChem (CID 143432016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).