About phenylurea;thiourea
phenylurea;thiourea (PubChem CID 160770333) has the molecular formula C8H12N4OS
and a molecular weight of 212.28 g/mol. Its IUPAC name is phenylurea;thiourea.
Molecular Properties
| Compound Name | phenylurea;thiourea |
| PubChem CID | 160770333 |
| Molecular Formula | C8H12N4OS |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | phenylurea;thiourea |
| SMILES | NC(=O)Nc1ccccc1.NC(N)=S |
| InChI | InChI=1S/C7H8N2O.CH4N2S/c8-7(10)9-6-4-2-1-3-5-6;2-1(3)4/h1-5H,(H3,8,9,10);(H4,2,3,4) |
| InChIKey | RZFQODZURXEAHM-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze phenylurea;thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylurea;thiourea?
The IUPAC name of phenylurea;thiourea (CID 160770333) is phenylurea;thiourea.
What is the SMILES notation for phenylurea;thiourea?
The canonical SMILES for phenylurea;thiourea is NC(=O)Nc1ccccc1.NC(N)=S.
What is the InChIKey of phenylurea;thiourea?
The InChIKey is RZFQODZURXEAHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O.CH4N2S/c8-7(10)9-6-4-2-1-3-5-6;2-1(3)4/h1-5H,(H3,8,9,10);(H4,2,3,4).
What are the key properties of phenylurea;thiourea?
phenylurea;thiourea has a molecular weight of 212.28 g/mol, XLogP of 0.37, 1 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenylurea;thiourea is sourced from PubChem (CID 160770333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).