About carbamic acid;methane;phenylcarbamic acid
carbamic acid;methane;phenylcarbamic acid (PubChem CID 70508846) has the molecular formula C12H25N3O6
and a molecular weight of 307.35 g/mol. Its IUPAC name is carbamic acid;methane;phenylcarbamic acid.
Molecular Properties
| Compound Name | carbamic acid;methane;phenylcarbamic acid |
| PubChem CID | 70508846 |
| Molecular Formula | C12H25N3O6 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | carbamic acid;methane;phenylcarbamic acid |
| SMILES | C.C.C.NC(=O)O.NC(=O)O.O=C(O)Nc1ccccc1 |
| InChI | InChI=1S/C7H7NO2.2CH3NO2.3CH4/c9-7(10)8-6-4-2-1-3-5-6;2*2-1(3)4;;;/h1-5,8H,(H,9,10);2*2H2,(H,3,4);3*1H4 |
| InChIKey | KBPYKUXNWVLTIQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 175.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze carbamic acid;methane;phenylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;methane;phenylcarbamic acid?
The IUPAC name of carbamic acid;methane;phenylcarbamic acid (CID 70508846) is carbamic acid;methane;phenylcarbamic acid.
What is the SMILES notation for carbamic acid;methane;phenylcarbamic acid?
The canonical SMILES for carbamic acid;methane;phenylcarbamic acid is C.C.C.NC(=O)O.NC(=O)O.O=C(O)Nc1ccccc1.
What is the InChIKey of carbamic acid;methane;phenylcarbamic acid?
The InChIKey is KBPYKUXNWVLTIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.2CH3NO2.3CH4/c9-7(10)8-6-4-2-1-3-5-6;2*2-1(3)4;;;/h1-5,8H,(H,9,10);2*2H2,(H,3,4);3*1H4.
What are the key properties of carbamic acid;methane;phenylcarbamic acid?
carbamic acid;methane;phenylcarbamic acid has a molecular weight of 307.35 g/mol, XLogP of 2.93, 1 rotatable bonds, 6 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;methane;phenylcarbamic acid is sourced from PubChem (CID 70508846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).