About ethenoxyethene;phenylcarbamic acid
ethenoxyethene;phenylcarbamic acid (PubChem CID 159140981) has the molecular formula C11H13NO3
and a molecular weight of 207.23 g/mol. Its IUPAC name is ethenoxyethene;phenylcarbamic acid.
Molecular Properties
| Compound Name | ethenoxyethene;phenylcarbamic acid |
| PubChem CID | 159140981 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | ethenoxyethene;phenylcarbamic acid |
| SMILES | C=COC=C.O=C(O)Nc1ccccc1 |
| InChI | InChI=1S/C7H7NO2.C4H6O/c9-7(10)8-6-4-2-1-3-5-6;1-3-5-4-2/h1-5,8H,(H,9,10);3-4H,1-2H2 |
| InChIKey | KIBYXUNLWCNHAD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethenoxyethene;phenylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenoxyethene;phenylcarbamic acid?
The IUPAC name of ethenoxyethene;phenylcarbamic acid (CID 159140981) is ethenoxyethene;phenylcarbamic acid.
What is the SMILES notation for ethenoxyethene;phenylcarbamic acid?
The canonical SMILES for ethenoxyethene;phenylcarbamic acid is C=COC=C.O=C(O)Nc1ccccc1.
What is the InChIKey of ethenoxyethene;phenylcarbamic acid?
The InChIKey is KIBYXUNLWCNHAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C4H6O/c9-7(10)8-6-4-2-1-3-5-6;1-3-5-4-2/h1-5,8H,(H,9,10);3-4H,1-2H2.
What are the key properties of ethenoxyethene;phenylcarbamic acid?
ethenoxyethene;phenylcarbamic acid has a molecular weight of 207.23 g/mol, XLogP of 3.07, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethenoxyethene;phenylcarbamic acid is sourced from PubChem (CID 159140981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).