C14H22O3 — CID 118954321
ethane-1,2-diol;ethenoxyethene;1,2-xylene (PubChem CID 118954321) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is ethane-1,2-diol;ethenoxyethene;1,2-xylene.
| Compound Name | ethane-1,2-diol;ethenoxyethene;1,2-xylene |
|---|---|
| PubChem CID | 118954321 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | ethane-1,2-diol;ethenoxyethene;1,2-xylene |
| SMILES | C=COC=C.Cc1ccccc1C.OCCO |
| InChI | InChI=1S/C8H10.C4H6O.C2H6O2/c1-7-5-3-4-6-8(7)2;1-3-5-4-2;3-1-2-4/h3-6H,1-2H3;3-4H,1-2H2;3-4H,1-2H2 |
| InChIKey | NMLILSOWHQBTOE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|