About ethenoxyethene;1-ethenyl-2-methylbenzene
ethenoxyethene;1-ethenyl-2-methylbenzene (PubChem CID 175558522) has the molecular formula C13H16O
and a molecular weight of 188.27 g/mol. Its IUPAC name is ethenoxyethene;1-ethenyl-2-methylbenzene.
Molecular Properties
| Compound Name | ethenoxyethene;1-ethenyl-2-methylbenzene |
| PubChem CID | 175558522 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | ethenoxyethene;1-ethenyl-2-methylbenzene |
| SMILES | C=COC=C.C=Cc1ccccc1C |
| InChI | InChI=1S/C9H10.C4H6O/c1-3-9-7-5-4-6-8(9)2;1-3-5-4-2/h3-7H,1H2,2H3;3-4H,1-2H2 |
| InChIKey | FEXGVMSUDKMWRU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethenoxyethene;1-ethenyl-2-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenoxyethene;1-ethenyl-2-methylbenzene?
The IUPAC name of ethenoxyethene;1-ethenyl-2-methylbenzene (CID 175558522) is ethenoxyethene;1-ethenyl-2-methylbenzene.
What is the SMILES notation for ethenoxyethene;1-ethenyl-2-methylbenzene?
The canonical SMILES for ethenoxyethene;1-ethenyl-2-methylbenzene is C=COC=C.C=Cc1ccccc1C.
What is the InChIKey of ethenoxyethene;1-ethenyl-2-methylbenzene?
The InChIKey is FEXGVMSUDKMWRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10.C4H6O/c1-3-9-7-5-4-6-8(9)2;1-3-5-4-2/h3-7H,1H2,2H3;3-4H,1-2H2.
What are the key properties of ethenoxyethene;1-ethenyl-2-methylbenzene?
ethenoxyethene;1-ethenyl-2-methylbenzene has a molecular weight of 188.27 g/mol, XLogP of 3.93, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethenoxyethene;1-ethenyl-2-methylbenzene is sourced from PubChem (CID 175558522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).