About 1-ethenyl-2-methylbenzene;2-methyl-2-phenyloxirane
1-ethenyl-2-methylbenzene;2-methyl-2-phenyloxirane (PubChem CID 178075043) has the molecular formula C18H20O
and a molecular weight of 252.36 g/mol. Its IUPAC name is 1-ethenyl-2-methylbenzene;2-methyl-2-phenyloxirane.
Molecular Properties
| Compound Name | 1-ethenyl-2-methylbenzene;2-methyl-2-phenyloxirane |
| PubChem CID | 178075043 |
| Molecular Formula | C18H20O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 1-ethenyl-2-methylbenzene;2-methyl-2-phenyloxirane |
| SMILES | C=Cc1ccccc1C.CC1(c2ccccc2)CO1 |
| InChI | InChI=1S/C9H10O.C9H10/c1-9(7-10-9)8-5-3-2-4-6-8;1-3-9-7-5-4-6-8(9)2/h2-6H,7H2,1H3;3-7H,1H2,2H3 |
| InChIKey | HTBSZRYVEREJCJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-2-methylbenzene;2-methyl-2-phenyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-2-methylbenzene;2-methyl-2-phenyloxirane?
The IUPAC name of 1-ethenyl-2-methylbenzene;2-methyl-2-phenyloxirane (CID 178075043) is 1-ethenyl-2-methylbenzene;2-methyl-2-phenyloxirane.
What is the SMILES notation for 1-ethenyl-2-methylbenzene;2-methyl-2-phenyloxirane?
The canonical SMILES for 1-ethenyl-2-methylbenzene;2-methyl-2-phenyloxirane is C=Cc1ccccc1C.CC1(c2ccccc2)CO1.
What is the InChIKey of 1-ethenyl-2-methylbenzene;2-methyl-2-phenyloxirane?
The InChIKey is HTBSZRYVEREJCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O.C9H10/c1-9(7-10-9)8-5-3-2-4-6-8;1-3-9-7-5-4-6-8(9)2/h2-6H,7H2,1H3;3-7H,1H2,2H3.
What are the key properties of 1-ethenyl-2-methylbenzene;2-methyl-2-phenyloxirane?
1-ethenyl-2-methylbenzene;2-methyl-2-phenyloxirane has a molecular weight of 252.36 g/mol, XLogP of 4.57, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-2-methylbenzene;2-methyl-2-phenyloxirane is sourced from PubChem (CID 178075043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).