About 1-ethenyl-2-methylbenzene;heptane
1-ethenyl-2-methylbenzene;heptane (PubChem CID 173354339) has the molecular formula C16H26
and a molecular weight of 218.38 g/mol. Its IUPAC name is 1-ethenyl-2-methylbenzene;heptane.
Molecular Properties
| Compound Name | 1-ethenyl-2-methylbenzene;heptane |
| PubChem CID | 173354339 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 1-ethenyl-2-methylbenzene;heptane |
| SMILES | C=Cc1ccccc1C.CCCCCCC |
| InChI | InChI=1S/C9H10.C7H16/c1-3-9-7-5-4-6-8(9)2;1-3-5-7-6-4-2/h3-7H,1H2,2H3;3-7H2,1-2H3 |
| InChIKey | KFPSETBKLQLPIG-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-2-methylbenzene;heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-2-methylbenzene;heptane?
The IUPAC name of 1-ethenyl-2-methylbenzene;heptane (CID 173354339) is 1-ethenyl-2-methylbenzene;heptane.
What is the SMILES notation for 1-ethenyl-2-methylbenzene;heptane?
The canonical SMILES for 1-ethenyl-2-methylbenzene;heptane is C=Cc1ccccc1C.CCCCCCC.
What is the InChIKey of 1-ethenyl-2-methylbenzene;heptane?
The InChIKey is KFPSETBKLQLPIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10.C7H16/c1-3-9-7-5-4-6-8(9)2;1-3-5-7-6-4-2/h3-7H,1H2,2H3;3-7H2,1-2H3.
What are the key properties of 1-ethenyl-2-methylbenzene;heptane?
1-ethenyl-2-methylbenzene;heptane has a molecular weight of 218.38 g/mol, XLogP of 5.61, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-2-methylbenzene;heptane is sourced from PubChem (CID 173354339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).