About 1-ethenyl-2-methylbenzene;trimethylazanium
1-ethenyl-2-methylbenzene;trimethylazanium (PubChem CID 18465530) has the molecular formula C12H20N+
and a molecular weight of 178.30 g/mol. Its IUPAC name is 1-ethenyl-2-methylbenzene;trimethylazanium.
Molecular Properties
| Compound Name | 1-ethenyl-2-methylbenzene;trimethylazanium |
| PubChem CID | 18465530 |
| Molecular Formula | C12H20N+ |
| Molecular Weight | 178.30 g/mol |
| Exact Mass | 178.16 |
| IUPAC Name | 1-ethenyl-2-methylbenzene;trimethylazanium |
| SMILES | C=Cc1ccccc1C.C[NH+](C)C |
| InChI | InChI=1S/C9H10.C3H9N/c1-3-9-7-5-4-6-8(9)2;1-4(2)3/h3-7H,1H2,2H3;1-3H3/p+1 |
| InChIKey | BMHMYYUIHBEPOB-UHFFFAOYSA-O |
| XLogP | 1.40 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-ethenyl-2-methylbenzene;trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-2-methylbenzene;trimethylazanium?
The IUPAC name of 1-ethenyl-2-methylbenzene;trimethylazanium (CID 18465530) is 1-ethenyl-2-methylbenzene;trimethylazanium.
What is the SMILES notation for 1-ethenyl-2-methylbenzene;trimethylazanium?
The canonical SMILES for 1-ethenyl-2-methylbenzene;trimethylazanium is C=Cc1ccccc1C.C[NH+](C)C.
What is the InChIKey of 1-ethenyl-2-methylbenzene;trimethylazanium?
The InChIKey is BMHMYYUIHBEPOB-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H10.C3H9N/c1-3-9-7-5-4-6-8(9)2;1-4(2)3/h3-7H,1H2,2H3;1-3H3/p+1.
What are the key properties of 1-ethenyl-2-methylbenzene;trimethylazanium?
1-ethenyl-2-methylbenzene;trimethylazanium has a molecular weight of 178.30 g/mol, XLogP of 1.40, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-2-methylbenzene;trimethylazanium is sourced from PubChem (CID 18465530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).