About 1-ethenyl-2-ethyl-4-methylbenzene;1-ethenyl-2-methylbenzene
1-ethenyl-2-ethyl-4-methylbenzene;1-ethenyl-2-methylbenzene (PubChem CID 173409250) has the molecular formula C20H24
and a molecular weight of 264.41 g/mol. Its IUPAC name is 1-ethenyl-2-ethyl-4-methylbenzene;1-ethenyl-2-methylbenzene.
Molecular Properties
| Compound Name | 1-ethenyl-2-ethyl-4-methylbenzene;1-ethenyl-2-methylbenzene |
| PubChem CID | 173409250 |
| Molecular Formula | C20H24 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | 1-ethenyl-2-ethyl-4-methylbenzene;1-ethenyl-2-methylbenzene |
| SMILES | C=Cc1ccc(C)cc1CC.C=Cc1ccccc1C |
| InChI | InChI=1S/C11H14.C9H10/c1-4-10-7-6-9(3)8-11(10)5-2;1-3-9-7-5-4-6-8(9)2/h4,6-8H,1,5H2,2-3H3;3-7H,1H2,2H3 |
| InChIKey | XDTVHLCTWQOVNG-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-ethenyl-2-ethyl-4-methylbenzene;1-ethenyl-2-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-2-ethyl-4-methylbenzene;1-ethenyl-2-methylbenzene?
The IUPAC name of 1-ethenyl-2-ethyl-4-methylbenzene;1-ethenyl-2-methylbenzene (CID 173409250) is 1-ethenyl-2-ethyl-4-methylbenzene;1-ethenyl-2-methylbenzene.
What is the SMILES notation for 1-ethenyl-2-ethyl-4-methylbenzene;1-ethenyl-2-methylbenzene?
The canonical SMILES for 1-ethenyl-2-ethyl-4-methylbenzene;1-ethenyl-2-methylbenzene is C=Cc1ccc(C)cc1CC.C=Cc1ccccc1C.
What is the InChIKey of 1-ethenyl-2-ethyl-4-methylbenzene;1-ethenyl-2-methylbenzene?
The InChIKey is XDTVHLCTWQOVNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14.C9H10/c1-4-10-7-6-9(3)8-11(10)5-2;1-3-9-7-5-4-6-8(9)2/h4,6-8H,1,5H2,2-3H3;3-7H,1H2,2H3.
What are the key properties of 1-ethenyl-2-ethyl-4-methylbenzene;1-ethenyl-2-methylbenzene?
1-ethenyl-2-ethyl-4-methylbenzene;1-ethenyl-2-methylbenzene has a molecular weight of 264.41 g/mol, XLogP of 5.84, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-2-ethyl-4-methylbenzene;1-ethenyl-2-methylbenzene is sourced from PubChem (CID 173409250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).