About ethenylcyclohexane;1-ethenyl-2-methylbenzene
ethenylcyclohexane;1-ethenyl-2-methylbenzene (PubChem CID 174828850) has the molecular formula C17H24
and a molecular weight of 228.38 g/mol. Its IUPAC name is ethenylcyclohexane;1-ethenyl-2-methylbenzene.
Molecular Properties
| Compound Name | ethenylcyclohexane;1-ethenyl-2-methylbenzene |
| PubChem CID | 174828850 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | ethenylcyclohexane;1-ethenyl-2-methylbenzene |
| SMILES | C=CC1CCCCC1.C=Cc1ccccc1C |
| InChI | InChI=1S/C9H10.C8H14/c1-3-9-7-5-4-6-8(9)2;1-2-8-6-4-3-5-7-8/h3-7H,1H2,2H3;2,8H,1,3-7H2 |
| InChIKey | BJVPFGHXRJOVDT-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethenylcyclohexane;1-ethenyl-2-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenylcyclohexane;1-ethenyl-2-methylbenzene?
The IUPAC name of ethenylcyclohexane;1-ethenyl-2-methylbenzene (CID 174828850) is ethenylcyclohexane;1-ethenyl-2-methylbenzene.
What is the SMILES notation for ethenylcyclohexane;1-ethenyl-2-methylbenzene?
The canonical SMILES for ethenylcyclohexane;1-ethenyl-2-methylbenzene is C=CC1CCCCC1.C=Cc1ccccc1C.
What is the InChIKey of ethenylcyclohexane;1-ethenyl-2-methylbenzene?
The InChIKey is BJVPFGHXRJOVDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10.C8H14/c1-3-9-7-5-4-6-8(9)2;1-2-8-6-4-3-5-7-8/h3-7H,1H2,2H3;2,8H,1,3-7H2.
What are the key properties of ethenylcyclohexane;1-ethenyl-2-methylbenzene?
ethenylcyclohexane;1-ethenyl-2-methylbenzene has a molecular weight of 228.38 g/mol, XLogP of 5.39, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethenylcyclohexane;1-ethenyl-2-methylbenzene is sourced from PubChem (CID 174828850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).