C17H28Si — CID 174747704
1-ethenyl-2-methylbenzene;1,1,2-trimethylsilinane (PubChem CID 174747704) has the molecular formula C17H28Si and a molecular weight of 260.50 g/mol. Its IUPAC name is 1-ethenyl-2-methylbenzene;1,1,2-trimethylsilinane.
| Compound Name | 1-ethenyl-2-methylbenzene;1,1,2-trimethylsilinane |
|---|---|
| PubChem CID | 174747704 |
| Molecular Formula | C17H28Si |
| Molecular Weight | 260.50 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 1-ethenyl-2-methylbenzene;1,1,2-trimethylsilinane |
| SMILES | C=Cc1ccccc1C.CC1CCCC[Si]1(C)C |
| InChI | InChI=1S/C9H10.C8H18Si/c1-3-9-7-5-4-6-8(9)2;1-8-6-4-5-7-9(8,2)3/h3-7H,1H2,2H3;8H,4-7H2,1-3H3 |
| InChIKey | XTWJWWBRNLNOLX-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.50 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|