C9H21SiTi- — CID 174291165
carbanide;titanium;1,1,2-trimethylsilinane (PubChem CID 174291165) has the molecular formula C9H21SiTi- and a molecular weight of 205.22 g/mol. Its IUPAC name is carbanide;titanium;1,1,2-trimethylsilinane.
| Compound Name | carbanide;titanium;1,1,2-trimethylsilinane |
|---|---|
| PubChem CID | 174291165 |
| Molecular Formula | C9H21SiTi- |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | carbanide;titanium;1,1,2-trimethylsilinane |
| SMILES | CC1CCCC[Si]1(C)C.[CH3-].[Ti] |
| InChI | InChI=1S/C8H18Si.CH3.Ti/c1-8-6-4-5-7-9(8,2)3;;/h8H,4-7H2,1-3H3;1H3;/q;-1; |
| InChIKey | BGHSMGJQNKNTRE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|