About carbanide;titanium;1,1,2-trimethylsilinane
carbanide;titanium;1,1,2-trimethylsilinane (PubChem CID 174291165) has the molecular formula C9H21SiTi-
and a molecular weight of 205.22 g/mol. Its IUPAC name is carbanide;titanium;1,1,2-trimethylsilinane.
Molecular Properties
| Compound Name | carbanide;titanium;1,1,2-trimethylsilinane |
| PubChem CID | 174291165 |
| Molecular Formula | C9H21SiTi- |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | carbanide;titanium;1,1,2-trimethylsilinane |
| SMILES | CC1CCCC[Si]1(C)C.[CH3-].[Ti] |
| InChI | InChI=1S/C8H18Si.CH3.Ti/c1-8-6-4-5-7-9(8,2)3;;/h8H,4-7H2,1-3H3;1H3;/q;-1; |
| InChIKey | BGHSMGJQNKNTRE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze carbanide;titanium;1,1,2-trimethylsilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;titanium;1,1,2-trimethylsilinane?
The IUPAC name of carbanide;titanium;1,1,2-trimethylsilinane (CID 174291165) is carbanide;titanium;1,1,2-trimethylsilinane.
What is the SMILES notation for carbanide;titanium;1,1,2-trimethylsilinane?
The canonical SMILES for carbanide;titanium;1,1,2-trimethylsilinane is CC1CCCC[Si]1(C)C.[CH3-].[Ti].
What is the InChIKey of carbanide;titanium;1,1,2-trimethylsilinane?
The InChIKey is BGHSMGJQNKNTRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18Si.CH3.Ti/c1-8-6-4-5-7-9(8,2)3;;/h8H,4-7H2,1-3H3;1H3;/q;-1;.
What are the key properties of carbanide;titanium;1,1,2-trimethylsilinane?
carbanide;titanium;1,1,2-trimethylsilinane has a molecular weight of 205.22 g/mol, XLogP of 3.72, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;titanium;1,1,2-trimethylsilinane is sourced from PubChem (CID 174291165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).