C8H18Si — CID 140812457
(2R)-1-ethyl-1,2-dimethylsilolane (PubChem CID 140812457) has the molecular formula C8H18Si and a molecular weight of 142.32 g/mol. Its IUPAC name is (2R)-1-ethyl-1,2-dimethylsilolane.
| Compound Name | (2R)-1-ethyl-1,2-dimethylsilolane |
|---|---|
| PubChem CID | 140812457 |
| Molecular Formula | C8H18Si |
| Molecular Weight | 142.32 g/mol |
| Exact Mass | 142.12 |
| IUPAC Name | (2R)-1-ethyl-1,2-dimethylsilolane |
| SMILES | CC[Si]1(C)CCC[C@H]1C |
| InChI | InChI=1S/C8H18Si/c1-4-9(3)7-5-6-8(9)2/h8H,4-7H2,1-3H3/t8-,9?/m1/s1 |
| InChIKey | OBHUUIHQBODGKZ-VEDVMXKPSA-N |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|