molecular hydrogen;1,1,2-trimethylsilinane

C8H20Si — CID 174301801

IUPACmolecular hydrogen;1,1,2-trimethylsilinane
SMILESCC1CCCC[Si]1(C)C.[H][H]
InChIInChI=1S/C8H18Si.H2/c1-8-6-4-5-7-9(8,2)3;/h8H,4-7H2,1-3H3;1H
InChIKeyZSZZDOWKZFRXLR-UHFFFAOYSA-N
MW144.33 g/mol
LogP3.51
Rot. Bonds

About molecular hydrogen;1,1,2-trimethylsilinane

molecular hydrogen;1,1,2-trimethylsilinane (PubChem CID 174301801) has the molecular formula C8H20Si and a molecular weight of 144.33 g/mol. Its IUPAC name is molecular hydrogen;1,1,2-trimethylsilinane.

Molecular Properties

Compound Namemolecular hydrogen;1,1,2-trimethylsilinane
PubChem CID174301801
Molecular FormulaC8H20Si
Molecular Weight144.33 g/mol
Exact Mass144.13
IUPAC Namemolecular hydrogen;1,1,2-trimethylsilinane
SMILESCC1CCCC[Si]1(C)C.[H][H]
InChIInChI=1S/C8H18Si.H2/c1-8-6-4-5-7-9(8,2)3;/h8H,4-7H2,1-3H3;1H
InChIKeyZSZZDOWKZFRXLR-UHFFFAOYSA-N
XLogP3.51
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500144.33
LogP ≤ 53.51
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze molecular hydrogen;1,1,2-trimethylsilinane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;1,1,2-trimethylsilinane?
The IUPAC name of molecular hydrogen;1,1,2-trimethylsilinane (CID 174301801) is molecular hydrogen;1,1,2-trimethylsilinane.
What is the SMILES notation for molecular hydrogen;1,1,2-trimethylsilinane?
The canonical SMILES for molecular hydrogen;1,1,2-trimethylsilinane is CC1CCCC[Si]1(C)C.[H][H].
What is the InChIKey of molecular hydrogen;1,1,2-trimethylsilinane?
The InChIKey is ZSZZDOWKZFRXLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18Si.H2/c1-8-6-4-5-7-9(8,2)3;/h8H,4-7H2,1-3H3;1H.
What are the key properties of molecular hydrogen;1,1,2-trimethylsilinane?
molecular hydrogen;1,1,2-trimethylsilinane has a molecular weight of 144.33 g/mol, XLogP of 3.51, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;1,1,2-trimethylsilinane is sourced from PubChem (CID 174301801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).